Introduction：Basic information about CAS 889942-69-2|5-Chloro-2-methyl-1H-indole-3-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-Chloro-2-methyl-1H-indole-3-carboxylic acid |
|---|
| CAS Number | 889942-69-2 | Molecular Weight | 209.629 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 440.7±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H8ClNO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 220.4±27.3 °C |
|---|
Names
| Name | 5-chloro-2-methyl-1H-indole-3-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 440.7±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H8ClNO2 |
|---|
| Molecular Weight | 209.629 |
|---|
| Flash Point | 220.4±27.3 °C |
|---|
| Exact Mass | 209.024353 |
|---|
| PSA | 53.09000 |
|---|
| LogP | 3.23 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.701 |
|---|
| InChIKey | SNWNOZKZEGWJPD-UHFFFAOYSA-N |
|---|
| SMILES | Cc1[nH]c2ccc(Cl)cc2c1C(=O)O |
|---|
Synonyms
| 1H-Indole-3-carboxylicacid,5-chloro-2-methyl |
| 1H-Indole-3-carboxylic acid, 5-chloro-2-methyl- |
| 5-Chloro-2-methyl-1H-indole-3-carboxylic acid |
| 1H-Indole-3-carboxylicacid,5-chloro-2-methyl- |
