Introduction：Basic information about CAS 286014-42-4|1,3-Bis(1-adamantyl)imidazolium tetrafluoroborate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,3-Bis(1-adamantyl)imidazolium tetrafluoroborate |
|---|
| CAS Number | 286014-42-4 | Molecular Weight | 424.326 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C23H33BF4N2 | Melting Point | 277-282ºC |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | 1,3-bis(1-adamantyl)imidazol-1-ium,tetrafluoroborate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Melting Point | 277-282ºC |
|---|
| Molecular Formula | C23H33BF4N2 |
|---|
| Molecular Weight | 424.326 |
|---|
| Exact Mass | 424.267303 |
|---|
| PSA | 8.81000 |
|---|
| LogP | 5.92620 |
|---|
| InChIKey | KVWCCJYLKCSVME-UHFFFAOYSA-N |
|---|
| SMILES | F[B-](F)(F)F.c1c[n+](C23CC4CC(CC(C4)C2)C3)cn1C12CC3CC(CC(C3)C1)C2 |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| 1,3-Di(adamantan-1-yl)-1H-imidazol-3-ium tetrafluoroborate |
| MFCD04973311 |
| IAd.HBF4 |
| 1,3-Di(1-adaMantyl)iMidazoliuM Tetrafluoroborate |
