Introduction：Basic information about CAS 32230-08-3|2-(5-chloropyridin-2-yl)oxy-2-methylpropanoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(5-chloropyridin-2-yl)oxy-2-methylpropanoic acid |
|---|
| CAS Number | 32230-08-3 | Molecular Weight | 215.63400 |
|---|
| Density | 1.324g/cm3 | Boiling Point | 316.165ºC at 760 mmHg |
|---|
| Molecular Formula | C9H10ClNO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 145.011ºC |
|---|
Names
| Name | 2-(5-chloropyridin-2-yl)oxy-2-methylpropanoic acid |
|---|
Chemical & Physical Properties
| Density | 1.324g/cm3 |
|---|
| Boiling Point | 316.165ºC at 760 mmHg |
|---|
| Molecular Formula | C9H10ClNO3 |
|---|
| Molecular Weight | 215.63400 |
|---|
| Flash Point | 145.011ºC |
|---|
| Exact Mass | 215.03500 |
|---|
| PSA | 59.42000 |
|---|
| LogP | 1.97700 |
|---|
| Index of Refraction | 1.543 |
|---|
| InChIKey | DORYZHTVUAFKQK-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(Oc1ccc(Cl)cn1)C(=O)O |
|---|
