Introduction：Basic information about CAS 3230-35-1|6-nitronaphthalen-2-amine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6-nitronaphthalen-2-amine |
|---|
| CAS Number | 3230-35-1 | Molecular Weight | 188.18300 |
|---|
| Density | 1.4±0.1g/cm3 | Boiling Point | 404.5±18.0°C at 760 mmHg |
|---|
| Molecular Formula | C10H8N2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 198.5±21.2°C |
|---|
Names
| Name | 6-nitronaphthalen-2-amine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1g/cm3 |
|---|
| Boiling Point | 404.5±18.0°C at 760 mmHg |
|---|
| Molecular Formula | C10H8N2O2 |
|---|
| Molecular Weight | 188.18300 |
|---|
| Flash Point | 198.5±21.2°C |
|---|
| Exact Mass | 188.05900 |
|---|
| PSA | 71.84000 |
|---|
| LogP | 3.43460 |
|---|
| InChIKey | LNYJXDMWSMEVGQ-UHFFFAOYSA-N |
|---|
| SMILES | Nc1ccc2cc([N+](=O)[O-])ccc2c1 |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2921450090 |
|---|
Customs
| HS Code | 2921450090 |
|---|
| Summary | 2921450090 1-naphthylamine (α-naphthylamine), 2-naphthylamine (β-naphthylamine) and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| 6-nitro-2-naphthalenamine |
| 6-Nitro-2-amino-naphthalin |
| 2-amino-6-nitronaphthalene |
| 2-Amino-6-nitro-naphthalin |
| 2-Naphthalenamine,6-nitro |
| 6-Nitro-2-naphthylamine |
