Introduction:Basic information about CAS 898282-25-2|2-METHOXY-5-NITRO-3-PICOLINE, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-METHOXY-5-NITRO-3-PICOLINE |
|---|
| CAS Number | 898282-25-2 | Molecular Weight | 356.84400 |
|---|
| Density | 1.203g/cm3 | Boiling Point | 454.7ºC at 760 mmHg |
|---|
| Molecular Formula | C17H25ClN2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 228.8ºC |
|---|
Names
| Name | (2S)-4-benzyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperazine-2-carboxylic acid |
|---|
Chemical & Physical Properties
| Density | 1.203g/cm3 |
|---|
| Boiling Point | 454.7ºC at 760 mmHg |
|---|
| Molecular Formula | C17H25ClN2O4 |
|---|
| Molecular Weight | 356.84400 |
|---|
| Flash Point | 228.8ºC |
|---|
| Exact Mass | 356.15000 |
|---|
| PSA | 70.08000 |
|---|
| LogP | 2.87030 |
|---|
| Index of Refraction | 1.556 |
|---|
| InChIKey | ZGEORLKSWXAMBW-AWEZNQCLSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)N1CCN(Cc2ccccc2)CC1C(=O)O |
|---|