Introduction：Basic information about CAS 220462-01-1|4-(3-Methyl-1H-pyrazol-1-yl)-2-trifluoromethylbenzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(3-Methyl-1H-pyrazol-1-yl)-2-trifluoromethylbenzoic acid |
|---|
| CAS Number | 220462-01-1 | Molecular Weight | 270.207 |
|---|
| Density | 1.4±0.0 g/cm3 | Boiling Point | 365.9±0.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H9F3N2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 175.1±0.0 °C |
|---|
Names
| Name | 4-(3-Methyl-1H-pyrazol-1-yl)-2-(trifluoromethyl)-benzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.0 g/cm3 |
|---|
| Boiling Point | 365.9±0.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H9F3N2O2 |
|---|
| Molecular Weight | 270.207 |
|---|
| Flash Point | 175.1±0.0 °C |
|---|
| Exact Mass | 270.061615 |
|---|
| PSA | 55.12000 |
|---|
| LogP | 3.22 |
|---|
| Vapour Pressure | 0.0±0.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.552 |
|---|
| InChIKey | HGKPNPICICLENG-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccn(-c2ccc(C(=O)O)c(C(F)(F)F)c2)n1 |
|---|
Synonyms
| Benzoic acid, 4-(3-methyl-1H-pyrazol-1-yl)-2-(trifluoromethyl)- |
| 4-(3-Methyl-1H-pyrazol-1-yl)-2-trifluoromethylbenzoic acid |
| 4-(3-Methyl-1H-pyrazol-1-yl)-2-(trifluoromethyl)benzoic acid |
| 4-(3-Methyl-1H-pyrazol-1-yl)-2-trifluoromethyl benzoic acid |
