Introduction：Basic information about CAS 7498-88-6|3-Butenoic acid, 4,4-diphenyl-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Butenoic acid, 4,4-diphenyl- |
|---|
| CAS Number | 7498-88-6 | Molecular Weight | 238.28100 |
|---|
| Density | 1.145g/cm3 | Boiling Point | 396.7ºC at 760 mmHg |
|---|
| Molecular Formula | C16H14O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 293.5ºC |
|---|
Names
| Name | 4,4-diphenylbut-3-enoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.145g/cm3 |
|---|
| Boiling Point | 396.7ºC at 760 mmHg |
|---|
| Molecular Formula | C16H14O2 |
|---|
| Molecular Weight | 238.28100 |
|---|
| Flash Point | 293.5ºC |
|---|
| Exact Mass | 238.09900 |
|---|
| PSA | 37.30000 |
|---|
| LogP | 3.59300 |
|---|
| Index of Refraction | 1.602 |
|---|
| InChIKey | MGPHWSQUSKFMKT-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)CC=C(c1ccccc1)c1ccccc1 |
|---|
Safety Information
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 4,4-diphenyl-but-3-enoic acid |
| 3-Butenoic acid,4-diphenyl |
| 1.1-Diphenyl-propen-(1)-carbonsaeure-(3) |
| 4,4-Diphenyl-but-3-ensaeure |
| 3-Butenoic acid,4,4-diphenyl |
| 4,4-Diphenyl-3-butenoic acid |
