Introduction:Basic information about CAS 4073-98-7|4,4'-Methylenebis(2,6-dimethylaniline), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4,4'-Methylenebis(2,6-dimethylaniline) |
|---|
| CAS Number | 4073-98-7 | Molecular Weight | 254.370 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 424.9±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C17H22N2 | Melting Point | 121-123 °C(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 252.5±26.8 °C |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | 4,4'-Methylenebis(2,6-dimethylaniline) |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 424.9±40.0 °C at 760 mmHg |
|---|
| Melting Point | 121-123 °C(lit.) |
|---|
| Molecular Formula | C17H22N2 |
|---|
| Molecular Weight | 254.370 |
|---|
| Flash Point | 252.5±26.8 °C |
|---|
| Exact Mass | 254.178299 |
|---|
| PSA | 52.04000 |
|---|
| LogP | 3.48 |
|---|
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.616 |
|---|
| InChIKey | OMHOXRVODFQGCA-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(Cc2cc(C)c(N)c(C)c2)cc(C)c1N |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H302-H312-H315-H319-H332-H335 |
|---|
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xn:Harmful; |
|---|
| Risk Phrases | R20/21/22;R36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2921590090 |
|---|
Customs
| HS Code | 2921590090 |
|---|
| Summary | 2921590090. other aromatic polyamines and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 3,3'5,5'-Tetramethyl-4,4'-diaminodiphenylmethane |
| Benzenamine, 4,4'-methylenebis[2,6-dimethyl- |
| 4-(4-Amino-3,5-dimethylbenzyl)-2,6-dimethylaniline |
| 4,4'-Methylenebis(2,6-dimethylaniline) |
| 4,4'-METHYLENEDI-2,6-XYLIDINE |
| 4,4'-diamino-3,3',5,5'-tetramethyl-diphenylmethane |
| 2,2',6,6'-Tetramethyl-4,4'-methylendiphenylamin |
| EINECS 223-786-9 |
| AURORA KA-6230 |
| MFCD00058680 |
| 4,4'-diamino-3,5,3',5'-tetramethyldiphenylmethane |
| 4,4'-methanediylbis(2,6-dimethylaniline) |