Introduction:Basic information about CAS 2212-76-2|Z-Lys(Boc)-OH.DCHA, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Z-Lys(Boc)-OH.DCHA |
|---|
| CAS Number | 2212-76-2 | Molecular Weight | 561.753 |
|---|
| Density | / | Boiling Point | 587ºC at 760 mmHg |
|---|
| Molecular Formula | C31H51N3O6 | Melting Point | 154-156ºC |
|---|
| MSDS | USA | Flash Point | 308.8ºC |
|---|
Names
| Name | N-cyclohexylcyclohexanamine,(2S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(phenylmethoxycarbonylamino)hexanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 587ºC at 760 mmHg |
|---|
| Melting Point | 154-156ºC |
|---|
| Molecular Formula | C31H51N3O6 |
|---|
| Molecular Weight | 561.753 |
|---|
| Flash Point | 308.8ºC |
|---|
| Exact Mass | 561.377808 |
|---|
| PSA | 125.99000 |
|---|
| LogP | 7.47510 |
|---|
| Vapour Pressure | 1.26E-14mmHg at 25°C |
|---|
| InChIKey | VTDLJMATIHSOTR-RSAXXLAASA-N |
|---|
| SMILES | C1CCC(NC2CCCCC2)CC1.CC(C)(C)OC(=O)NCCCCC(NC(=O)OCc1ccccc1)C(=O)O |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| L-Lysine, N-[(1,1-dimethylethoxy)carbonyl]-N-[(phenylmethoxy)carbonyl]-, compd. with N-cyclohexylcyclohexanamine (1:1) |
| N-[(Benzyloxy)carbonyl]-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-lysine - N-cyclohexylcyclohexanamine (1:1) |
| EINECS 218-663-1 |
| N-Cbz-N'-Boc-L-lysine dicyclohexylamine |
| compound with dicyclohexylamine (1:1) |
| Z-Lys(Boc)-OH (dicyclohexylammonium) salt |
| Z-Lys(Boc)-OH.DCHA |
| N2-[(benzyloxy)carbonyl]-N6-(tert-butoxycarbonyl)-L-lysine |
| Z-Lys(Boc)-OH dicyclohexylamine salt |
| Z-Lys(Boc)-OH*HN(C6H11)2 |
| Dicyclohexylamine (S)-2-(((benzyloxy)carbonyl)amino)-6-((tert-butoxycarbonyl)amino)hexanoate |
| (2S)-2-{[(Benzyloxy)carbonyl]amino}-6-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)hexanoic acid - N-cyclohexylcyclohexanamine (1:1) |
| N2-(benzyloxycarbonyl)-N6-<(tert-butoxy)carbonyl>lysin-dicyclohexylamin |
| Z-Lys(Boc)-OH·DCHA |