Introduction:Basic information about CAS 88149-49-9|2,6-Dibromo-4-(trifluoromethoxy)aniline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,6-Dibromo-4-(trifluoromethoxy)aniline |
|---|
| CAS Number | 88149-49-9 | Molecular Weight | 334.916 |
|---|
| Density | 2.0±0.1 g/cm3 | Boiling Point | 253.8±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C7H4Br2F3NO | Melting Point | 70-74 °C(lit.) |
|---|
| MSDS | / | Flash Point | 107.3±25.9 °C |
|---|
Names
| Name | 2,6-Dibromo-4-(trifluoromethoxy)aniline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 2.0±0.1 g/cm3 |
|---|
| Boiling Point | 253.8±35.0 °C at 760 mmHg |
|---|
| Melting Point | 70-74 °C(lit.) |
|---|
| Molecular Formula | C7H4Br2F3NO |
|---|
| Molecular Weight | 334.916 |
|---|
| Flash Point | 107.3±25.9 °C |
|---|
| Exact Mass | 332.861145 |
|---|
| PSA | 35.25000 |
|---|
| LogP | 4.49 |
|---|
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.558 |
|---|
| InChIKey | JBSWOEGXMADXOU-UHFFFAOYSA-N |
|---|
| SMILES | Nc1c(Br)cc(OC(F)(F)F)cc1Br |
|---|
Safety Information
| Hazard Codes | Xi:Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2922299090 |
|---|
Customs
| HS Code | 2922299090 |
|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 3,5-DIBROMO-4-AMINOTRIFLUOROMETHOXY BENZENE |
| 4-Amino-3,5-dibromotrifluoromethoxybenzene |
| 2,6-Dibromo-4-(trifluoromethoxy)aniline |
| 3,5-dibromo-5-AminoTrifluoromethoxybenzene |
| 3,5-Dibromo-4-Aminotrifluoromethoxy |
| Benzenamine, 2,6-dibromo-4-(trifluoromethoxy)- |
| 4-trifluoromethoxy-2,6-dibromoaniline |
| 2,6-Dibromo-4-Trifluoro-Methoxy aniline |
| 3.5-Dibromo-4-Aminotrifluoromethoxybenzen |
| MFCD00153113 |