Introduction：Basic information about CAS 23602-98-4|Dibenzo[b,d]furan-2-sulfonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Dibenzo[b,d]furan-2-sulfonyl chloride |
|---|
| CAS Number | 23602-98-4 | Molecular Weight | 266.700 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 420.5±18.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H7ClO3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 208.1±21.2 °C |
|---|
Names
| Name | dibenzofuran-2-sulfonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 420.5±18.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H7ClO3S |
|---|
| Molecular Weight | 266.700 |
|---|
| Flash Point | 208.1±21.2 °C |
|---|
| Exact Mass | 265.980438 |
|---|
| PSA | 55.66000 |
|---|
| LogP | 3.89 |
|---|
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.694 |
|---|
| InChIKey | ULCKEERECJMLHP-UHFFFAOYSA-N |
|---|
| SMILES | O=S(=O)(Cl)c1ccc2oc3ccccc3c2c1 |
|---|
Safety Information
| Hazard Codes | C: Corrosive; |
|---|
| HS Code | 2932999099 |
|---|
Customs
| HS Code | 2932999099 |
|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| dibenzofuran-2-sulphonic acid chloride |
| Dibenzofuran-2-sulfonylchlorid |
| 2-Dibenzofuransulfonyl chloride |
| 2-chlorosulfonyldibenzofuran |
| 3-dibenzofuransulfonyl chloride |
| Dibenzo[b,d]furan-2-sulfonyl chloride |
| 2-dibenzofuransulphonyl chloride |
