Introduction:Basic information about CAS 892869-42-0|(3beta)-3-[[(2E)-3-(4-Chlorophenyl)-1-oxo-2-propenyl]oxy]-olean-12-en-28-oic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (3beta)-3-[[(2E)-3-(4-Chlorophenyl)-1-oxo-2-propenyl]oxy]-olean-12-en-28-oic acid |
|---|
| CAS Number | 892869-42-0 | Molecular Weight | 621.28900 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C39H53ClO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | (3beta)-3-[[(2E)-3-(4-Chlorophenyl)-1-oxo-2-propenyl]oxy]-olean-12-en-28-oic acid |
|---|
Chemical & Physical Properties
| Molecular Formula | C39H53ClO4 |
|---|
| Molecular Weight | 621.28900 |
|---|
| Exact Mass | 620.36300 |
|---|
| PSA | 63.60000 |
|---|
| LogP | 10.15130 |
|---|
| Index of Refraction | 1.582 |
|---|
| InChIKey | VVRRKSVMSIMNKI-CEDKKCENSA-N |
|---|
| SMILES | CC1(C)CCC2(C(=O)O)CCC3(C)C(=CCC4C5(C)CCC(OC(=O)C=Cc6ccc(Cl)cc6)C(C)(C)C5CCC43C)C2C1 |
|---|