Introduction：Basic information about CAS 23589-16-4|Adenosine, N-phenyl-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Adenosine, N-phenyl- |
|---|
| CAS Number | 23589-16-4 | Molecular Weight | 343.33700 |
|---|
| Density | 1.68g/cm3 | Boiling Point | 697.4ºC at 760 mmHg |
|---|
| Molecular Formula | C16H17N5O4 | Melting Point | 187-188ºC(lit.) |
|---|
| MSDS | / | Flash Point | 375.6ºC |
|---|
Names
| Name | n6-phenyladenosine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.68g/cm3 |
|---|
| Boiling Point | 697.4ºC at 760 mmHg |
|---|
| Melting Point | 187-188ºC(lit.) |
|---|
| Molecular Formula | C16H17N5O4 |
|---|
| Molecular Weight | 343.33700 |
|---|
| Flash Point | 375.6ºC |
|---|
| Exact Mass | 343.12800 |
|---|
| PSA | 125.55000 |
|---|
| LogP | 0.25440 |
|---|
| Vapour Pressure | 2.05E-20mmHg at 25°C |
|---|
| Index of Refraction | 1.787 |
|---|
| InChIKey | QVUUUSJUORLECR-XNIJJKJLSA-N |
|---|
| SMILES | OCC1OC(n2cnc3c(Nc4ccccc4)ncnc32)C(O)C1O |
|---|
Synonyms
| 6-Phenylethylaminopurine |
| N6-Phenaethyladenin |
| MFCD00055129 |
