Introduction：Basic information about CAS 94166-58-2|2-aminopyridine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-aminopyridine |
|---|
| CAS Number | 94166-58-2 | Molecular Weight | 183.16500 |
|---|
| Density | 1.327g/cm3 | Boiling Point | 204-210ºC(lit.) |
|---|
| Molecular Formula | C7H9N3O3 | Melting Point | 54-58ºC(lit.) |
|---|
| MSDS | / | Flash Point | 204-210ºC(lit.) |
|---|
Names
| Name | 6-methoxy-N-methyl-3-nitropyridin-2-amine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.327g/cm3 |
|---|
| Boiling Point | 204-210ºC(lit.) |
|---|
| Melting Point | 54-58ºC(lit.) |
|---|
| Molecular Formula | C7H9N3O3 |
|---|
| Molecular Weight | 183.16500 |
|---|
| Flash Point | 204-210ºC(lit.) |
|---|
| Exact Mass | 183.06400 |
|---|
| PSA | 79.97000 |
|---|
| LogP | 1.63630 |
|---|
| Index of Refraction | 1.599 |
|---|
| InChIKey | RSFNGZVULJTWHW-UHFFFAOYSA-N |
|---|
| SMILES | CNc1nc(OC)ccc1[N+](=O)[O-] |
|---|
Safety Information
| Hazard Codes | T |
|---|
| Risk Phrases | 21-25-36/37/38 |
|---|
| Safety Phrases | 26-36/37/39-45 |
|---|
| RIDADR | UN 2671 6.1/PG 2 |
|---|
| WGK Germany | 3 |
|---|
| RTECS | US1575000 |
|---|
| HS Code | 2933399090 |
|---|
Customs
| HS Code | 2933399090 |
|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| EINECS 303-354-7 |
| OR3141 |
| EINECS 207-988-4 |
| 2-Methylamino-3-nitro-6-methoxypyridine |
| 6-methoxy-2-methylamino-3-nitropyridine |
| MFCD00006312 |
