Introduction：Basic information about CAS 121-55-1|subathizone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | subathizone |
|---|
| CAS Number | 121-55-1 | Molecular Weight | 271.35900 |
|---|
| Density | 1.36g/cm3 | Boiling Point | 477.9ºC at 760mmHg |
|---|
| Molecular Formula | C10H13N3O2S2 | Melting Point | 234-235° (dec) |
|---|
| MSDS | / | Flash Point | 242.8ºC |
|---|
Names
| Name | [(E)-(4-ethylsulfonylphenyl)methylideneamino]thiourea |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.36g/cm3 |
|---|
| Boiling Point | 477.9ºC at 760mmHg |
|---|
| Melting Point | 234-235° (dec) |
|---|
| Molecular Formula | C10H13N3O2S2 |
|---|
| Molecular Weight | 271.35900 |
|---|
| Flash Point | 242.8ºC |
|---|
| Exact Mass | 271.04500 |
|---|
| PSA | 125.02000 |
|---|
| LogP | 2.81930 |
|---|
| Vapour Pressure | 2.7E-09mmHg at 25°C |
|---|
| Index of Refraction | 1.63 |
|---|
| InChIKey | VUSKMERTTCJJPM-KPKJPENVSA-N |
|---|
| SMILES | CCS(=O)(=O)c1ccc(C=NNC(N)=S)cc1 |
|---|
Safety Information
Customs
| HS Code | 2930909090 |
|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| Ethizone |
| Ethiazone |
| Ethizon |
| EINECS 204-480-4 |
| 4-ethanesulfonyl-benzaldehyde-thiosemicarbazone |
| Berculon B |
| 4-Ethylsulfonylbenzaldehyde 3-thiosemicarbazone |
| Polyteben |
| SHCH-431 |
| subathizone |
| Ethicetazone |
| 4-Aethansulfonyl-benzaldehyd-thiosemicarbazon |
