Introduction：Basic information about CAS 4185-69-7|(2,4-Dinitrophenyl)pyridinium chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (2,4-Dinitrophenyl)pyridinium chloride |
|---|
| CAS Number | 4185-69-7 | Molecular Weight | 281.65200 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C11H8ClN3O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 1-(2,4-dinitrophenyl)pyridin-1-ium,chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C11H8ClN3O4 |
|---|
| Molecular Weight | 281.65200 |
|---|
| Exact Mass | 281.02000 |
|---|
| PSA | 95.52000 |
|---|
| InChIKey | UYHMQTNGMUDVIY-UHFFFAOYSA-M |
|---|
| SMILES | O=[N+]([O-])c1ccc(-[n+]2ccccc2)c([N+](=O)[O-])c1.[Cl-] |
|---|
Safety Information
Customs
| HS Code | 2933399090 |
|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| (2,4-Dinitrophenyl)pyridinium chloride |
| 1-(2,4-dinitrophenyl)pyridinium chloride,Zincke salt |
| N-(2,4-Dinitrophenyl)pyridinium chloride |
| (2,4-dinitrophenyl)pyridine,chloride |
| 1-(2,4-Dinitrophenyl)pyridiniuM Chloride |
| Zincke Salt |
| 1-(2,4-Dinitrophenyl)pyridinium chloride |
| Pyridinium,1-(2,4-dinitrophenyl)-,chloride |
