Introduction：Basic information about CAS 27328-68-3|(5-Chloro-1H-indazol-3-yl)acetic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (5-Chloro-1H-indazol-3-yl)acetic acid |
|---|
| CAS Number | 27328-68-3 | Molecular Weight | 210.617 |
|---|
| Density | 1.6±0.1 g/cm3 | Boiling Point | 463.9±30.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H7ClN2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 234.3±24.6 °C |
|---|
Names
| Name | 2-(5-chloro-2H-indazol-3-yl)acetic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.6±0.1 g/cm3 |
|---|
| Boiling Point | 463.9±30.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H7ClN2O2 |
|---|
| Molecular Weight | 210.617 |
|---|
| Flash Point | 234.3±24.6 °C |
|---|
| Exact Mass | 210.019608 |
|---|
| PSA | 65.98000 |
|---|
| LogP | 1.70 |
|---|
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.711 |
|---|
| InChIKey | OIQMRQZOCUNAIN-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)Cc1[nH]nc2ccc(Cl)cc12 |
|---|
Safety Information
Customs
| HS Code | 2933990090 |
|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 2-(5-chloro-1H-indazol-3-yl)acetic acid |
| 5-Chloro-3-(1H)indazole carboxylic acid |
| 5-chloro-3-indazoleacetic acid |
| 1H-Indazole-3-aceticacid,5-chloro |
| RW1894 |
| (5-Chloro-1H-indazol-3-yl)acetic acid |
| HID1930 |
| Rutiace |
| MFCD02326712 |
| 5-Chlor-1H-indazol-3-essigsaeure |
| 1H-indazole-3-acetic acid, 5-chloro- |
| 5-Chlor-1H-indazolyl-3-essigsaeure |
| 5-Chloro-1H-indazole-3-acetic acid |
| (5-chloro-1(2)H-indazol-3-yl)-acetic acid |
