Introduction:Basic information about CAS 108436-80-2|Rociclovir, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Rociclovir |
|---|
| CAS Number | 108436-80-2 | Molecular Weight | 323.39100 |
|---|
| Density | 1.26g/cm3 | Boiling Point | 508ºC at 760mmHg |
|---|
| Molecular Formula | C15H25N5O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 261ºC |
|---|
Names
| Name | 9-[1,3-di(propan-2-yloxy)propan-2-yloxymethyl]purin-2-amine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.26g/cm3 |
|---|
| Boiling Point | 508ºC at 760mmHg |
|---|
| Molecular Formula | C15H25N5O3 |
|---|
| Molecular Weight | 323.39100 |
|---|
| Flash Point | 261ºC |
|---|
| Exact Mass | 323.19600 |
|---|
| PSA | 97.31000 |
|---|
| LogP | 2.18240 |
|---|
| Vapour Pressure | 1.94E-10mmHg at 25°C |
|---|
| Index of Refraction | 1.582 |
|---|
| InChIKey | FBHWXSOQXQBXER-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)OCC(COC(C)C)OCn1cnc2cnc(N)nc21 |
|---|
Synonyms
| Rociclovirum |
| UNII-6DF29U51Y7 |
| Hoe 602 |
| Rociclovirum [INN-Latin] |
| Rociclovir |