Introduction：Basic information about CAS 89163-44-0|Cinaproxen, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Cinaproxen |
|---|
| CAS Number | 89163-44-0 | Molecular Weight | 375.43900 |
|---|
| Density | 1.284g/cm3 | Boiling Point | 635.4ºC at 760 mmHg |
|---|
| Molecular Formula | C19H21NO5S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 338.1ºC |
|---|
Names
| Name | (2R)-2-acetamido-3-[(2S)-2-(6-methoxynaphthalen-2-yl)propanoyl]sulfanylpropanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.284g/cm3 |
|---|
| Boiling Point | 635.4ºC at 760 mmHg |
|---|
| Molecular Formula | C19H21NO5S |
|---|
| Molecular Weight | 375.43900 |
|---|
| Flash Point | 338.1ºC |
|---|
| Exact Mass | 375.11400 |
|---|
| PSA | 118.00000 |
|---|
| LogP | 3.19190 |
|---|
| Index of Refraction | 1.609 |
|---|
| InChIKey | HDTMMJMHZFBNKY-GTNSWQLSSA-N |
|---|
| SMILES | COc1ccc2cc(C(C)C(=O)SCC(NC(C)=O)C(=O)O)ccc2c1 |
|---|
Synonyms
| UNII-1J0E0I69E9 |
| Cinaproxen |
| Cinaproxenum |
