Introduction：Basic information about CAS 469-78-3|Metheptazine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Metheptazine |
|---|
| CAS Number | 469-78-3 | Molecular Weight | 261.35900 |
|---|
| Density | 1.023g/cm3 | Boiling Point | 340.1ºC at 760mmHg |
|---|
| Molecular Formula | C16H23NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 111.2ºC |
|---|
Names
| Name | methyl 1,2-dimethyl-4-phenylazepane-4-carboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.023g/cm3 |
|---|
| Boiling Point | 340.1ºC at 760mmHg |
|---|
| Molecular Formula | C16H23NO2 |
|---|
| Molecular Weight | 261.35900 |
|---|
| Flash Point | 111.2ºC |
|---|
| Exact Mass | 261.17300 |
|---|
| PSA | 29.54000 |
|---|
| LogP | 2.53950 |
|---|
| Vapour Pressure | 8.77E-05mmHg at 25°C |
|---|
| Index of Refraction | 1.506 |
|---|
| InChIKey | RAAFYFKWMRWOIT-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)C1(c2ccccc2)CCCN(C)C(C)C1 |
|---|
Synonyms
| UNII-93X4R66P5A |
| Metheptazine |
| Metheptazine [INN] |
| 1,2-dimethyl-4-phenyl-hexahydro-azepine-4-carboxylic acid methyl ester |
| Methyl 1,2-dimethyl-4-phenyl-4-azepanylcarboxylat |
| 1,2-Dimethyl-4-phenyl-hexahydro-azepin-4-carbonsaeure-methylester |
