Introduction：Basic information about CAS 72808-81-2|Tepirindole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Tepirindole |
|---|
| CAS Number | 72808-81-2 | Molecular Weight | 274.78800 |
|---|
| Density | 1.187g/cm3 | Boiling Point | 442.1ºC at 760 mmHg |
|---|
| Molecular Formula | C16H19ClN2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 221.2ºC |
|---|
Names
| Name | Tepirindole |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.187g/cm3 |
|---|
| Boiling Point | 442.1ºC at 760 mmHg |
|---|
| Molecular Formula | C16H19ClN2 |
|---|
| Molecular Weight | 274.78800 |
|---|
| Flash Point | 221.2ºC |
|---|
| Exact Mass | 274.12400 |
|---|
| PSA | 19.03000 |
|---|
| LogP | 4.25830 |
|---|
| Index of Refraction | 1.624 |
|---|
| InChIKey | ZRCUMOBNOPSLKM-UHFFFAOYSA-N |
|---|
| SMILES | CCCN1CC=C(c2c[nH]c3ccc(Cl)cc23)CC1 |
|---|
Synonyms
| chloro-5 (propyl-1 tetrahydro-1,2,3,6 pyridinyl-4)-3 1H-indole |
| 5-Chloro-3-(1,2,3,6-tetrahydro-1-propylpyridin-4-yl)-1H-indole |
