Introduction：Basic information about CAS 101335-99-3|Eprovafen, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Eprovafen |
|---|
| CAS Number | 101335-99-3 | Molecular Weight | 302.43100 |
|---|
| Density | 1.137g/cm3 | Boiling Point | 463.5ºC at 760mmHg |
|---|
| Molecular Formula | C18H22O2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 234.1ºC |
|---|
Names
| Name | 5-[5-(3-phenylpropyl)thiophen-2-yl]pentanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.137g/cm3 |
|---|
| Boiling Point | 463.5ºC at 760mmHg |
|---|
| Molecular Formula | C18H22O2S |
|---|
| Molecular Weight | 302.43100 |
|---|
| Flash Point | 234.1ºC |
|---|
| Exact Mass | 302.13400 |
|---|
| PSA | 65.54000 |
|---|
| LogP | 4.72080 |
|---|
| Vapour Pressure | 2.17E-09mmHg at 25°C |
|---|
| Index of Refraction | 1.578 |
|---|
| InChIKey | DMDLRGRLIWYPQF-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)CCCCc1ccc(CCCc2ccccc2)s1 |
|---|
Synonyms
| 5-(3-phenylpropyl)-2-thiophenevaleric acid |
| 2-Thiophenepentanoicacid,5-(3-phenylpropyl) |
| 5-[5-(3-phenylpropyl)-thien-2-yl]-valeric acid |
| Eprovafen |
| Eprovafen [INN] |
