Introduction:Basic information about CAS 884512-09-8|(R)-tert-butyl 3-(3-chlorobenzoyl)piperidine-1-carboxylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (R)-tert-butyl 3-(3-chlorobenzoyl)piperidine-1-carboxylate |
|---|
| CAS Number | 884512-09-8 | Molecular Weight | 323.81400 |
|---|
| Density | 1.183g/cm3 | Boiling Point | 436.2ºC at 760 mmHg |
|---|
| Molecular Formula | C17H22ClNO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 217.6ºC |
|---|
Names
| Name | tert-butyl 3-(3-chlorobenzoyl)piperidine-1-carboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.183g/cm3 |
|---|
| Boiling Point | 436.2ºC at 760 mmHg |
|---|
| Molecular Formula | C17H22ClNO3 |
|---|
| Molecular Weight | 323.81400 |
|---|
| Flash Point | 217.6ºC |
|---|
| Exact Mass | 323.12900 |
|---|
| PSA | 46.61000 |
|---|
| LogP | 4.10770 |
|---|
| Index of Refraction | 1.54 |
|---|
| InChIKey | BAGDSBRGWXVOOH-CYBMUJFWSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)N1CCCC(C(=O)c2cccc(Cl)c2)C1 |
|---|
Synonyms
| tert-butyl (R)-3-(3-chlorobenzoyl)piperidine-1-carboxylate |
| tert-Butyl (3R)-3-[(3-chlorophenyl)carbonyl]-1-piperidinecarboxylate |
| tert-butyl 3-(3-chlorophenyl)carbonylpiperidine-1-carboxylate |
| (3-chlorophenyl)((R)-N-Boc-piperidin-3-yl)methanone |
| 3-[(3-chlorophenyl)-oxomethyl]-1-piperidinecarboxylic acid tert-butyl ester |