Introduction:Basic information about CAS 103966-66-1|4-Bromo-2-methoxy-1-nitrobenzene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Bromo-2-methoxy-1-nitrobenzene |
|---|
| CAS Number | 103966-66-1 | Molecular Weight | 232.031 |
|---|
| Density | 1.6±0.1 g/cm3 | Boiling Point | 298.7±20.0 °C at 760 mmHg |
|---|
| Molecular Formula | C7H6BrNO3 | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | 134.5±21.8 °C |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | 4-Bromo-2-methoxy-1-nitrobenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.6±0.1 g/cm3 |
|---|
| Boiling Point | 298.7±20.0 °C at 760 mmHg |
|---|
| Molecular Formula | C7H6BrNO3 |
|---|
| Molecular Weight | 232.031 |
|---|
| Flash Point | 134.5±21.8 °C |
|---|
| Exact Mass | 230.953094 |
|---|
| PSA | 55.05000 |
|---|
| LogP | 2.45 |
|---|
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.581 |
|---|
| InChIKey | DJKPQYBFSAJUBS-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc(Br)ccc1[N+](=O)[O-] |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H302-H312-H315-H319-H332-H335 |
|---|
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
|---|
| Hazard Codes | Xi |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| HS Code | 2909309090 |
|---|
Customs
| HS Code | 2909309090 |
|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 4-bromo-2-methoxy-1-nitro-benzene |
| 5-Bromo-2-nitroanisole |
| 5-Bromo-2-nitrophenyl methyl ether |
| 4-Bromo-2-methoxy-1-nitrobenzene |
| Benzene,4-bromo-2-methoxy-1-nitro |
| 2-nitro-5-bromoanisole |
| 5-Brom-2-nitro-1-methoxy-benzol |
| 3-methoxy-4-nitrobromobenzene |
| 5-bromo-1-methoxy-2-nitrobenzene |
| Benzene, 4-bromo-2-methoxy-1-nitro- |
| Methyl-(5-brom-2-nitro-phenyl)-aether |