Introduction：Basic information about CAS 661-97-2|1,2-dichlorohexafluoropropane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,2-dichlorohexafluoropropane |
|---|
| CAS Number | 661-97-2 | Molecular Weight | 220.92900 |
|---|
| Density | 1.304 g/cm3 | Boiling Point | 33-34ºC |
|---|
| Molecular Formula | C3Cl2F6 | Melting Point | -124.9°C |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 1,2-dichloro-1,1,2,3,3,3-hexafluoropropane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.304 g/cm3 |
|---|
| Boiling Point | 33-34ºC |
|---|
| Melting Point | -124.9°C |
|---|
| Molecular Formula | C3Cl2F6 |
|---|
| Molecular Weight | 220.92900 |
|---|
| Exact Mass | 219.92800 |
|---|
| LogP | 3.28490 |
|---|
| Index of Refraction | 1.3035 |
|---|
| InChIKey | JSEUKVSKOHVLOV-UHFFFAOYSA-N |
|---|
| SMILES | FC(F)(F)C(F)(Cl)C(F)(F)Cl |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | 20/21/22-36/37/38 |
|---|
| Safety Phrases | 26-36/37/39 |
|---|
Synonyms
| 1,2-Dichloroperfluoropropane |
| 1,2-C3F6Cl2 |
| 1,2-dichloro-1,1,2,3,3,3-hexafluoro-propane |
| Propane,dichlorohexafluoro |
| 1,1,1,2,3,3-hexafluoro-2,3-dichloropropane |
| CFC-216ba |
| Dichlorohexafluoropropane |
| 1,2-dichlorohexafluoropropane |
| Ucon 216 |
| Freon 216 |
| 2,3-dichloro-1,1,1,2,3,3-hexafluoropropane |
