Introduction：Basic information about CAS 56361-85-4|1-benzoyl-4-(1H-indol-3-yl)piperidine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-benzoyl-4-(1H-indol-3-yl)piperidine |
|---|
| CAS Number | 56361-85-4 | Molecular Weight | 304.38600 |
|---|
| Density | 1.211g/cm3 | Boiling Point | 533.7ºC at 760mmHg |
|---|
| Molecular Formula | C20H20N2O | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | [4-(1H-indol-3-yl)piperidin-1-yl]-phenylmethanone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.211g/cm3 |
|---|
| Boiling Point | 533.7ºC at 760mmHg |
|---|
| Molecular Formula | C20H20N2O |
|---|
| Molecular Weight | 304.38600 |
|---|
| Exact Mass | 304.15800 |
|---|
| PSA | 36.10000 |
|---|
| LogP | 4.12560 |
|---|
| Index of Refraction | 1.662 |
|---|
| InChIKey | YTURLADWFKSLFZ-UHFFFAOYSA-N |
|---|
| SMILES | O=C(c1ccccc1)N1CCC(c2c[nH]c3ccccc23)CC1 |
|---|
Synonyms
| 1-Benzoyl-4-(1H-indol-3-yl)piperidine |
| EINECS 260-131-6 |
| [4-(1h-indol-3-yl)piperidin-1-yl](phenyl)methanone |
| 1-Benzoyl-4-<indolyl-(3)>-piperidin |
| 1-benzoyl-4-indol-3-yl-piperidine |
