Introduction：Basic information about CAS 54419-31-7|Fenirofibrate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Fenirofibrate |
|---|
| CAS Number | 54419-31-7 | Molecular Weight | 320.76700 |
|---|
| Density | 1.297 g/cm3 | Boiling Point | 500.3ºCat 760 mmHg |
|---|
| Molecular Formula | C17H17ClO4 | Melting Point | 130-132ºC |
|---|
| MSDS | / | Flash Point | 256.4ºC |
|---|
Names
| Name | Fenirofibrate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.297 g/cm3 |
|---|
| Boiling Point | 500.3ºCat 760 mmHg |
|---|
| Melting Point | 130-132ºC |
|---|
| Molecular Formula | C17H17ClO4 |
|---|
| Molecular Weight | 320.76700 |
|---|
| Flash Point | 256.4ºC |
|---|
| Exact Mass | 320.08200 |
|---|
| PSA | 66.76000 |
|---|
| LogP | 3.66370 |
|---|
| Index of Refraction | 1.595 |
|---|
| InChIKey | ASDCLYXOQCGHNT-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(Oc1ccc(C(O)c2ccc(Cl)cc2)cc1)C(=O)O |
|---|
| Storage condition | -20°C |
|---|
Synonyms
| 2-[4-[(4-chlorophenyl)-hydroxymethyl]phenoxy]-2-methylpropanoic acid |
