Introduction：Basic information about CAS 59878-63-6|N-Desmethyl Zopiclone Hydrochloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-Desmethyl Zopiclone Hydrochloride |
|---|
| CAS Number | 59878-63-6 | Molecular Weight | 411.24300 |
|---|
| Density | 1.57g/cm3 | Boiling Point | 599ºC at 760 mmHg |
|---|
| Molecular Formula | C16H16Cl2N6O3 | Melting Point | 226-228ºC |
|---|
| MSDS | / | Flash Point | 316.1ºC |
|---|
Names
| Name | N-Desmethyl Zopiclone Hydrochloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.57g/cm3 |
|---|
| Boiling Point | 599ºC at 760 mmHg |
|---|
| Melting Point | 226-228ºC |
|---|
| Molecular Formula | C16H16Cl2N6O3 |
|---|
| Molecular Weight | 411.24300 |
|---|
| Flash Point | 316.1ºC |
|---|
| Exact Mass | 410.06600 |
|---|
| PSA | 100.55000 |
|---|
| LogP | 2.35950 |
|---|
| Index of Refraction | 1.696 |
|---|
| InChIKey | CGSFZSTXVVJLIX-UHFFFAOYSA-N |
|---|
| SMILES | O=C(OC1c2nccnc2C(=O)N1c1ccc(Cl)cn1)N1CCNCC1 |
|---|
Synonyms
| n-desmethyl zopiclone |
| Norzopiclone |
