Introduction:Basic information about CAS 99473-15-1|(E)-2,2-dimethyl-7-(naphthalen-1-ylmethylamino)hept-5-en-3-ynoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (E)-2,2-dimethyl-7-(naphthalen-1-ylmethylamino)hept-5-en-3-ynoic acid |
|---|
| CAS Number | 99473-15-1 | Molecular Weight | 307.38600 |
|---|
| Density | 1.143g/cm3 | Boiling Point | 518.4ºC at 760mmHg |
|---|
| Molecular Formula | C20H21NO2 | Melting Point | 158-160ºC (dec.) |
|---|
| MSDS | / | Flash Point | 267.3ºC |
|---|
Names
| Name | (E)-2,2-dimethyl-7-(naphthalen-1-ylmethylamino)hept-5-en-3-ynoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.143g/cm3 |
|---|
| Boiling Point | 518.4ºC at 760mmHg |
|---|
| Melting Point | 158-160ºC (dec.) |
|---|
| Molecular Formula | C20H21NO2 |
|---|
| Molecular Weight | 307.38600 |
|---|
| Flash Point | 267.3ºC |
|---|
| Exact Mass | 307.15700 |
|---|
| PSA | 49.33000 |
|---|
| LogP | 3.99070 |
|---|
| Index of Refraction | 1.615 |
|---|
| InChIKey | HLMXKUJHRUTHIL-XVNBXDOJSA-N |
|---|
| SMILES | CC(C)(C#CC=CCNCc1cccc2ccccc12)C(=O)O |
|---|
Synonyms
| 5-Hepten-3-ynoic acid,2,2-dimethyl-7-((1-naphthalenylmethyl)amino)-,(E) |
| N-Desmethylcarboxy Terbinafine |
| (5E)-2,2-Dimethyl-7-[(1-naphthalenylmethyl)amino]-5-hepten-3-ynoic Acid |