Introduction：Basic information about CAS 3272-91-1|1-Naphthalenamine,5-nitro-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-Naphthalenamine,5-nitro- |
|---|
| CAS Number | 3272-91-1 | Molecular Weight | 188.18300 |
|---|
| Density | 1.366g/cm3 | Boiling Point | 385.3ºC at 760mmHg |
|---|
| Molecular Formula | C10H8N2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 186.8ºC |
|---|
Names
| Name | 5-nitronaphthalen-1-amine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.366g/cm3 |
|---|
| Boiling Point | 385.3ºC at 760mmHg |
|---|
| Molecular Formula | C10H8N2O2 |
|---|
| Molecular Weight | 188.18300 |
|---|
| Flash Point | 186.8ºC |
|---|
| Exact Mass | 188.05900 |
|---|
| PSA | 71.84000 |
|---|
| LogP | 3.43460 |
|---|
| Index of Refraction | 1.728 |
|---|
| InChIKey | WEWILNPCZSSAIJ-UHFFFAOYSA-N |
|---|
| SMILES | Nc1cccc2c([N+](=O)[O-])cccc12 |
|---|
Safety Information
Customs
| HS Code | 2921450090 |
|---|
| Summary | 2921450090 1-naphthylamine (α-naphthylamine), 2-naphthylamine (β-naphthylamine) and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| 1-Naphthylamine,5-nitro |
| 5-nitro-1-aminonaphthalene |
| 5-nitronaphthylamine |
| 1-Amino-5-nitronaphthalene |
| 1-Naphthalenamine,5-nitro |
| 5-nitro-1-naphthylamine |
| 5-nitro-1-naphthalenamine |
| 5-Amino-1-nitronaphthalene |
| 1-Nitro-5-aminonaphthalene |
