Introduction：Basic information about CAS 6285-64-9|phenylazomalonamamidine hydrochloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | phenylazomalonamamidine hydrochloride |
|---|
| CAS Number | 6285-64-9 | Molecular Weight | 241.67700 |
|---|
| Density | 1.4g/cm3 | Boiling Point | 349.2ºC at 760 mmHg |
|---|
| Molecular Formula | C9H12ClN5O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 165ºC |
|---|
Names
| Name | 3-amino-3-imino-2-phenyldiazenylpropanamide,hydrochloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4g/cm3 |
|---|
| Boiling Point | 349.2ºC at 760 mmHg |
|---|
| Molecular Formula | C9H12ClN5O |
|---|
| Molecular Weight | 241.67700 |
|---|
| Flash Point | 165ºC |
|---|
| Exact Mass | 241.07300 |
|---|
| PSA | 117.68000 |
|---|
| LogP | 2.86250 |
|---|
| Index of Refraction | 1.664 |
|---|
| InChIKey | MWOBRIPIRLAVII-UHFFFAOYSA-N |
|---|
| SMILES | Cl.N=C(N)C(N=Nc1ccccc1)C(N)=O |
|---|
Synonyms
| phenylazomalonamamidine hydrochloride |
| 3-azanyl-3-azanylidene-2-phenyldiazenyl-propanamide hydrochloride |
| phenylazomalonamidamidine |
| 3-amino-3-imino-2-phenyldiazenylpropanamide hydrochloride |
| Temozolomide INT |
