Introduction：Basic information about CAS 24317-96-2|Benzenepropanoic acid, b-oxo-a-propyl-, ethyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzenepropanoic acid, b-oxo-a-propyl-, ethyl ester |
|---|
| CAS Number | 24317-96-2 | Molecular Weight | 234.29100 |
|---|
| Density | 1.046g/cm3 | Boiling Point | 313ºC at 760 mmHg |
|---|
| Molecular Formula | C14H18O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 133.5ºC |
|---|
Names
| Name | ethyl 2-benzoylpentanoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.046g/cm3 |
|---|
| Boiling Point | 313ºC at 760 mmHg |
|---|
| Molecular Formula | C14H18O3 |
|---|
| Molecular Weight | 234.29100 |
|---|
| Flash Point | 133.5ºC |
|---|
| Exact Mass | 234.12600 |
|---|
| PSA | 43.37000 |
|---|
| LogP | 2.84870 |
|---|
| Vapour Pressure | 0.000511mmHg at 25°C |
|---|
| Index of Refraction | 1.499 |
|---|
| InChIKey | VGSIFKKEDZIPEN-UHFFFAOYSA-N |
|---|
| SMILES | CCCC(C(=O)OCC)C(=O)c1ccccc1 |
|---|
Synonyms
| ethyl 2-benzoylvalerate |
| 2-propyl-3-oxo-3-phenylpropionic acid ethyl ester |
| 2-benzoyl-valeric acid ethyl ester |
| 2-Benzoyl-valeriansaeure-aethylester |
| 2-Propyl-2-benzoyl-essigsaeure-ethylester |
