Introduction：Basic information about CAS 24342-97-0|2,3,5,6-Tetrachloro-1,4-benzenedimethanamine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,3,5,6-Tetrachloro-1,4-benzenedimethanamine |
|---|
| CAS Number | 24342-97-0 | Molecular Weight | 273.97500 |
|---|
| Density | 1.546g/cm3 | Boiling Point | 368.5ºC at 760mmHg |
|---|
| Molecular Formula | C8H8Cl4N2 | Melting Point | 146-148ºC |
|---|
| MSDS | / | Flash Point | 176.7ºC |
|---|
Names
| Name | [4-(aminomethyl)-2,3,5,6-tetrachlorophenyl]methanamine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.546g/cm3 |
|---|
| Boiling Point | 368.5ºC at 760mmHg |
|---|
| Melting Point | 146-148ºC |
|---|
| Molecular Formula | C8H8Cl4N2 |
|---|
| Molecular Weight | 273.97500 |
|---|
| Flash Point | 176.7ºC |
|---|
| Exact Mass | 271.94400 |
|---|
| PSA | 52.04000 |
|---|
| LogP | 4.61820 |
|---|
| Vapour Pressure | 1.27E-05mmHg at 25°C |
|---|
| Index of Refraction | 1.626 |
|---|
| InChIKey | SEDAWQAAXOJIPH-UHFFFAOYSA-N |
|---|
| SMILES | NCc1c(Cl)c(Cl)c(CN)c(Cl)c1Cl |
|---|
Synonyms
| 2,3,5,6-Tetrachloro-1,4-benzenedimethanamine |
| 2,3,5,6-tetrachloro-p-xylylenediamine |
