Introduction：Basic information about CAS 2798-20-1|Gardenin B, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Gardenin B |
|---|
| CAS Number | 2798-20-1 | Molecular Weight | 358.342 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 582.0±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C19H18O7 | Melting Point | 180-181ºC |
|---|
| MSDS | / | Flash Point | 210.8±23.6 °C |
|---|
Names
| Name | gardenin B |
|---|
| Synonym | More Synonyms |
|---|
Gardenin B BiologicalActivity
| Description | Gardenin B is a flavonoid isolated from Baccharis scandens. Gardenin B induces cell death in human leukemia cells involves multiple caspases[1]. |
|---|
| Related Catalog | Signaling Pathways >>Apoptosis >>ApoptosisResearch Areas >>Cancer |
|---|
| References | [1]. Cabrera J, et al. Gardenin B-induced cell death in human leukemia cells involves multiple caspases but is independent of the generation of reactive oxygen species. Chem Biol Interact. 2016 Aug 25;256:220-7. |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 582.0±50.0 °C at 760 mmHg |
|---|
| Melting Point | 180-181ºC |
|---|
| Molecular Formula | C19H18O7 |
|---|
| Molecular Weight | 358.342 |
|---|
| Flash Point | 210.8±23.6 °C |
|---|
| Exact Mass | 358.105255 |
|---|
| PSA | 87.36000 |
|---|
| LogP | 2.27 |
|---|
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.593 |
|---|
| InChIKey | LXEVSYZNYDZSOB-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(-c2cc(=O)c3c(O)c(OC)c(OC)c(OC)c3o2)cc1 |
|---|
Safety Information
Synonyms
| 5-Hydroxy-4',6,7,8-tetramethoxyflavone |
| Demethyltangeretin |
| 4H-1-Benzopyran-4-one, 5-hydroxy-6,7,8-trimethoxy-2-(4-methoxyphenyl)- |
| 5-O-demethyltangeretin |
| Gardenin B |
| 5-Hydroxy-2-(4-methoxyphenyl)-6,7,8-trimethoxy-4H-1-benzopyran-4-one |
| 5-demethyltangeretin |
| 5-Hydroxy-6,7,8-trimethoxy-2-(4-methoxyphenyl)-4H-chromen-4-one |
| 5-hydroxy-6,7,8,4'-tetramethoxyflavone |
| 5-O-Desmethyltangeretin |
| 5-Hydroxy-6,7,8-trimethoxy-2-(4-methoxyphenyl)-4H-1-benzopyran-4-one |
| 6,7,8,4'-tetramethoxy-5-hydroxyflavone |
| 5-hydroxy-6,7,8-trimethoxy-2-(4-methoxyphenyl)chromen-4-one |
| 5-hydroxy-4',6,7,8-tetramethoxy-flavone |
