Introduction：Basic information about CAS 23815-28-3|Benzenesulfonamide,3,4-dichloro-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzenesulfonamide,3,4-dichloro- |
|---|
| CAS Number | 23815-28-3 | Molecular Weight | 226.08000 |
|---|
| Density | 1.588g/cm3 | Boiling Point | 383.4ºC at 760mmHg |
|---|
| Molecular Formula | C6H5Cl2NO2S | Melting Point | 137-139ºC |
|---|
| MSDS | / | Flash Point | 185.7ºC |
|---|
Names
| Name | 3,4-dichlorobenzenesulfonamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.588g/cm3 |
|---|
| Boiling Point | 383.4ºC at 760mmHg |
|---|
| Melting Point | 137-139ºC |
|---|
| Molecular Formula | C6H5Cl2NO2S |
|---|
| Molecular Weight | 226.08000 |
|---|
| Flash Point | 185.7ºC |
|---|
| Exact Mass | 224.94200 |
|---|
| PSA | 68.54000 |
|---|
| LogP | 3.42190 |
|---|
| Vapour Pressure | 4.39E-06mmHg at 25°C |
|---|
| Index of Refraction | 1.602 |
|---|
| InChIKey | ILLSOONBCBUBOD-UHFFFAOYSA-N |
|---|
| SMILES | NS(=O)(=O)c1ccc(Cl)c(Cl)c1 |
|---|
Synonyms
| 3,4-dichloro-benzenesulfonic acid amide |
| 3,4-dichlorobenzenesulphonamide |
| 3.4-Dichlor-benzolsulfonamid-(1) |
| F1084-0743 |
| 3,4-chlorobenzenesulfonamide |
| 3,4-Dichloro-benzenesulfonamide |
| 3,4-Dichlor-benzolsulfonsaeure-amid |
