Introduction：Basic information about CAS 7481-27-8|Copper,bis[O,O-bis(1-methylethyl) phosphorodithioato-kS,kS']-, (SP-4-1)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Copper,bis[O,O-bis(1-methylethyl) phosphorodithioato-kS,kS']-, (SP-4-1)- |
|---|
| CAS Number | 7481-27-8 | Molecular Weight | 277.83200 |
|---|
| Density | 1.145g/cm3 | Boiling Point | 257.1ºC at 760 mmHg |
|---|
| Molecular Formula | C6H15CuO2PS2++ | Melting Point | / |
|---|
| MSDS | / | Flash Point | 109.3ºC |
|---|
Names
| Name | Phosphorodithioic acid, O,O-diisopropyl ester, copper(2+) salt |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.145g/cm3 |
|---|
| Boiling Point | 257.1ºC at 760 mmHg |
|---|
| Molecular Formula | C6H15CuO2PS2++ |
|---|
| Molecular Weight | 277.83200 |
|---|
| Flash Point | 109.3ºC |
|---|
| Exact Mass | 276.95500 |
|---|
| PSA | 99.16000 |
|---|
| LogP | 3.63880 |
|---|
| Index of Refraction | 1.502 |
|---|
| InChIKey | YGIKBHDCMKLPLX-UHFFFAOYSA-L |
|---|
| SMILES | CC(C)OP(=S)([S-])OC(C)C.CC(C)OP(=S)([S-])OC(C)C.[Cu+2] |
|---|
Synonyms
| copper bis(O,O-diisopropyl) bis(dithiophosphate) |
| Cu diisopropyldithiophosphate |
| Bis(diisopropoxythiophophinylthio)copper(II) |
| Phosphorodithioic acid,o,o-bis(1-methylethyl) ester,copper(2+) salt |
| bis[O,O-bis(1-methylethyl) phosphorodithioato-S,S']-,(SP-4-1)-Copper |
| Copper,bis[O,O-bis(1-methylethyl)phosphorodithioato-S,S']-,(SP-4-1) |
| o-bis(1-methylethyl) phosphorodithioato-s,s']-bis[ (sp-4-1)-copper |
