Introduction：Basic information about CAS 52962-26-2|BENZOIC ACID, 2-(1-ACETYL-2-OXOPROPYL)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | BENZOIC ACID, 2-(1-ACETYL-2-OXOPROPYL)- |
|---|
| CAS Number | 52962-26-2 | Molecular Weight | 220.22100 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C12H12O4 | Melting Point | / |
|---|
| MSDS | USA | Flash Point | / |
|---|
Names
| Name | 2-(2,4-dioxopentan-3-yl)benzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C12H12O4 |
|---|
| Molecular Weight | 220.22100 |
|---|
| Exact Mass | 220.07400 |
|---|
| PSA | 71.44000 |
|---|
| LogP | 1.64640 |
|---|
| InChIKey | CKPUMDIQROCRDB-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)C(C(C)=O)c1ccccc1C(=O)O |
|---|
Safety Information
Customs
| HS Code | 2918300090 |
|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| 3-(o-carboxyphenyl)pentane-2,4-dione |
| 2-<1-Acetyl-2-oxo-propyl>-benzoesaeure |
| 2-Diacetylmethyl-benzoesaeure |
| 3-(2-Carboxy-phenyl)-pentandion-(2.4) |
| 3-(2-Carboxyphenyl)pentane-2,4-dione |
| 2-(1-acetyl-2-oxo-propyl)-benzoic acid |
| ms-(2-Carboxy-phenyl)-acetylaceton |
