Introduction：Basic information about CAS 103030-10-0|Methyl 2,3-dioxoindoline-7-carboxylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methyl 2,3-dioxoindoline-7-carboxylate |
|---|
| CAS Number | 103030-10-0 | Molecular Weight | 205.16700 |
|---|
| Density | 1.411g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C10H7NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Methyl 2,3-dioxoindoline-7-carboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.411g/cm3 |
|---|
| Molecular Formula | C10H7NO4 |
|---|
| Molecular Weight | 205.16700 |
|---|
| Exact Mass | 205.03800 |
|---|
| PSA | 72.47000 |
|---|
| LogP | 0.74600 |
|---|
| Index of Refraction | 1.592 |
|---|
| InChIKey | BKMLLFWFPNUDNF-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1cccc2c1NC(=O)C2=O |
|---|
Safety Information
Customs
| HS Code | 2933990090 |
|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 7-Methoxycarbonylamino-4-methylcoumarin |
| methyl isatin-7-carboxylate |
| methyl 2,3-dioxoindole-7-carboxylate |
| 7-methoxycarbonylisatin |
| methyl (4-methyl-2-oxo-2H-chromen-7-yl)carbamate |
| methyl 7-isatincarboxylate |
| Carbamic acid,(4-methyl-2-oxo-2H-1-benzopyran-7-yl)-,methyl ester |
| 2,3-dioxo-2,3-dihydro-1H-indole-7-carboxylic acid methyl ester |
| 2,3-dioxo-indoline-7-carboxylic acid methyl ester |
