Introduction:Basic information about CAS 10546-67-5|2,6-Dibromo-4-(tert-butyl)aniline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,6-Dibromo-4-(tert-butyl)aniline |
|---|
| CAS Number | 10546-67-5 | Molecular Weight | 307.02500 |
|---|
| Density | 1.609 | Boiling Point | 288ºC |
|---|
| Molecular Formula | C10H13Br2N | Melting Point | / |
|---|
| MSDS | / | Flash Point | 128ºC |
|---|
Names
| Name | 2,6-Dibromo-4-tert-butylaniline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.609 |
|---|
| Boiling Point | 288ºC |
|---|
| Molecular Formula | C10H13Br2N |
|---|
| Molecular Weight | 307.02500 |
|---|
| Flash Point | 128ºC |
|---|
| Exact Mass | 304.94100 |
|---|
| PSA | 26.02000 |
|---|
| LogP | 4.67250 |
|---|
| InChIKey | FEHTXNYXDWPZCQ-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)c1cc(Br)c(N)c(Br)c1 |
|---|
Safety Information
Customs
| HS Code | 2921420090 |
|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 2,6-Dibrom-4-tert-butyl-anilin |
| 4-tert-butyl-2,6-dibromoaniline |
| 2,6-dibromo-4-tert-butylbenzenamine |
| 4-t-butyl-2,6-dibromoaniline |
| 2,6-Dibromo-4-(tert-butyl)aniline |