Introduction：Basic information about CAS 950-59-4|2,6-di-tert-butyl-4-sulfanylphenol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,6-di-tert-butyl-4-sulfanylphenol |
|---|
| CAS Number | 950-59-4 | Molecular Weight | 238.389 |
|---|
| Density | 1.0±0.1 g/cm3 | Boiling Point | 302.3±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H22OS | Melting Point | / |
|---|
| MSDS | / | Flash Point | 136.6±27.9 °C |
|---|
Names
| Name | 2,6-ditert-butyl-4-sulfanylphenol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.0±0.1 g/cm3 |
|---|
| Boiling Point | 302.3±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H22OS |
|---|
| Molecular Weight | 238.389 |
|---|
| Flash Point | 136.6±27.9 °C |
|---|
| Exact Mass | 238.139130 |
|---|
| PSA | 59.03000 |
|---|
| LogP | 5.06 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.537 |
|---|
| InChIKey | NFVMNXZFSKGLDR-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)c1cc(S)cc(C(C)(C)C)c1O |
|---|
Safety Information
| Safety Phrases | S22-S26-S36/37/39 |
|---|
| HS Code | 2930909090 |
|---|
Customs
| HS Code | 2930909090 |
|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 2,6-bis(tert-butyl)-4-sulfanylphenol |
| EINECS 213-451-5 |
| 3,5-di-tert-butyl-4-hydroxyphenylthiol |
| 3,5-di-t-butyl-4-hydroxyphenylmercaptane |
| 4-hydroxy-3,5-di-tert-butylphenylthiol |
| 3,5-di-tert-butyl-4-hydroxybenzenethiol |
| 4-hydroxy-3,5-di-t-butylbenzenethiol |
| 2,6-Di-tert-butyl-4-mercaptophenol |
| 2,6-di-tert-butyl-4-sulfanylphenol |
| 2,6-bis(1,1-dimethylethyl)-4-mercaptophenol |
| 2,6-Di-tert-butyl-4-thiophenol |
| 2,6-Bis(2-methyl-2-propanyl)-4-sulfanylphenol |
| Phenol, 2,6-bis(1,1-dimethylethyl)-4-mercapto- |
| 3,5-di-tert-butyl-4hydroxythiophenol |
