Introduction:Basic information about CAS 95093-95-1|(S)-(+)-4-(2,3-Epoxypropoxy)carbazole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (S)-(+)-4-(2,3-Epoxypropoxy)carbazole |
|---|
| CAS Number | 95093-95-1 | Molecular Weight | 239.26900 |
|---|
| Density | 1.327g/cm3 | Boiling Point | 464.9ºC at 760 mmHg |
|---|
| Molecular Formula | C15H13NO2 | Melting Point | 158-160ºC |
|---|
| MSDS | / | Flash Point | 166.4ºC |
|---|
Names
| Name | (S)-(+)-4-(2,3-Epoxypropoxy)carbazole |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.327g/cm3 |
|---|
| Boiling Point | 464.9ºC at 760 mmHg |
|---|
| Melting Point | 158-160ºC |
|---|
| Molecular Formula | C15H13NO2 |
|---|
| Molecular Weight | 239.26900 |
|---|
| Flash Point | 166.4ºC |
|---|
| Exact Mass | 239.09500 |
|---|
| PSA | 37.55000 |
|---|
| LogP | 3.09870 |
|---|
| Index of Refraction | 1.729 |
|---|
| InChIKey | SVWKIGRDISDRLO-JTQLQIEISA-N |
|---|
| SMILES | c1ccc2c(c1)[nH]c1cccc(OCC3CO3)c12 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2933990090 |
|---|
Customs
| HS Code | 2933990090 |
|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 4-(2-hydroxy-5,7-dimethyl-4-oxo-6,8-nonadienyl)-2,6-piperidinedione |
| streptimidone |
| Protomycin |
| Streptoimidone |
| (S)-2-(carbazol-4-yl-oxymethyl)oxirane |
| 4-[(2S)-oxiranylmethoxy]-9H-carbazole |
| 4-(L-erythro-2-hydroxy-5,7-dimethyl-4-oxo-nona-6t,8-dienyl)-piperidine-2,6-dione |
| (S)-4-(2,3-epoxypropoxy)carbazole |
| 4-[(2R,5S,6E)-2-Hydroxy-5,7-dimethyl-4-oxo-6,8-nonadienyl]-2,6-piperidinedione |
| S-(+)-4-(oxiranylmethoxy)-9H-carbazole |
| Streptimidon |
| 4-[(2S)-oxiran-2-ylmethoxy]-9H-carbazole |
| (S)-3-(9H-carbazol-4-yloxy)-1,2-epoxypropane |
| 4-(L-erythro-2-Hydroxy-5,7-dimethyl-4-oxo-nona-6t,8-dienyl)-piperidin-2,6-dion |
| 4-[(2'R,5'S,6'E)-2'-hydroxy-5',7'-dimethyl-4'-oxonona-6',8'-dienyl]piperidine-2,6-dione |