Introduction：Basic information about CAS 60814-16-6|2-(4-Nitrophenoxy)ethanamine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(4-Nitrophenoxy)ethanamine |
|---|
| CAS Number | 60814-16-6 | Molecular Weight | 182.177 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 345.1±22.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H10N2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 162.5±22.3 °C |
|---|
Names
| Name | 2-(4-Nitrophenoxy)ethanamine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 345.1±22.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H10N2O3 |
|---|
| Molecular Weight | 182.177 |
|---|
| Flash Point | 162.5±22.3 °C |
|---|
| Exact Mass | 182.069138 |
|---|
| PSA | 81.07000 |
|---|
| LogP | 0.79 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.569 |
|---|
| InChIKey | HIEVUCALPWFEFA-UHFFFAOYSA-N |
|---|
| SMILES | NCCOc1ccc([N+](=O)[O-])cc1 |
|---|
Safety Information
Customs
| HS Code | 2922299090 |
|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| Ethanamine,2-(4-nitrophenoxy) |
| 2-(p-nitrophenoxy)ethylamine |
| 2-(3,4-DICHLOROPHENYL)QUINOLINE-4-CARBOHYDRAZIDE |
| 2-(4-Nitrophenoxy)ethanamine |
| p-nitrophenoxyethylamine |
| Ethanamine, 2-(4-nitrophenoxy)- |
| 4-Nitrophenyl 2-aminoethyl ether |
| 2-(4-Nitrophenoxy)ethylamine |
| 2-(4-nitrophenoxy)-ethylamine |
| 2-(4-Nitro-phenoxy)-aethylamin |
| 2-(4-Nitrophenoxy)-1-ethanamine |
