Introduction：Basic information about CAS 5545-54-0|Z-Tyr(tbu)-oh, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Z-Tyr(tbu)-oh |
|---|
| CAS Number | 5545-54-0 | Molecular Weight | 371.427 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 556.8±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C21H25NO5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 290.5±30.1 °C |
|---|
Names
| Name | (S)-2-(((Benzyloxy)carbonyl)amino)-3-(4-(tert-butoxy)phenyl)propanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 556.8±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C21H25NO5 |
|---|
| Molecular Weight | 371.427 |
|---|
| Flash Point | 290.5±30.1 °C |
|---|
| Exact Mass | 371.173279 |
|---|
| PSA | 88.35000 |
|---|
| LogP | 4.72 |
|---|
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.562 |
|---|
| InChIKey | YKVBQSGNGCKQSV-SFHVURJKSA-N |
|---|
| SMILES | CC(C)(C)Oc1ccc(CC(NC(=O)OCc2ccccc2)C(=O)O)cc1 |
|---|
Synonyms
| (2S)-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]-2-(phenylmethoxycarbonylamino)propanoic acid |
| N-[(Benzyloxy)carbonyl]-O-(2-methyl-2-propanyl)-L-tyrosine |
| L-Tyrosine, O-(1,1-dimethylethyl)-N-[(phenylmethoxy)carbonyl]- |
| Z-Tyr(tbu)-oh |
