Introduction：Basic information about CAS 83509-88-0|(S)-3-benzyloxycarbonylaminobutyric acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (S)-3-benzyloxycarbonylaminobutyric acid |
|---|
| CAS Number | 83509-88-0 | Molecular Weight | 237.25200 |
|---|
| Density | 1.213±0.06 g/cm3 | Boiling Point | 435.6±38.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H15NO4 | Melting Point | 105-107 °C |
|---|
| MSDS | USA | Flash Point | / |
|---|
Names
| Name | (3S)-3-(phenylmethoxycarbonylamino)butanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.213±0.06 g/cm3 |
|---|
| Boiling Point | 435.6±38.0 °C at 760 mmHg |
|---|
| Melting Point | 105-107 °C |
|---|
| Molecular Formula | C12H15NO4 |
|---|
| Molecular Weight | 237.25200 |
|---|
| Exact Mass | 237.10000 |
|---|
| PSA | 79.12000 |
|---|
| LogP | 1.98040 |
|---|
| InChIKey | HYWJKPFAIAWVHP-VIFPVBQESA-N |
|---|
| SMILES | CC(CC(=O)O)NC(=O)OCc1ccccc1 |
|---|
Safety Information
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|
| Hazard Codes | Xi |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2924299090 |
|---|
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| (3S)-benzyloxycarbonylaminobutyric acid |
| Z-L-|A-Homoalanine |
| Z-|A-Homoala-OH |
| (3S)-N-benzyloxycarbonyl-3-aminobutanoic acid |
| (S)-3-<(benzyoxycarbonyl)amino>butanoic acid |
| (S)-3-(Z-amino)butyric acid |
| (S)-3-benzyloxycarbonylaminobutyric acid |
| (S)-3-{[(benzyloxy)carbonyl]amino}butanoic acid |
| Cbz-L-3-Aminobutyric acid |
