Introduction:Basic information about CAS 220352-36-3|(1R,2R)-2-(3,4-difluorophenyl)cyclopropane-1-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (1R,2R)-2-(3,4-difluorophenyl)cyclopropane-1-carboxylic acid |
|---|
| CAS Number | 220352-36-3 | Molecular Weight | 198.166 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 308.1±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H8F2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 140.1±27.9 °C |
|---|
Names
| Name | (1R,2R)-2-(3,4-difluorophenyl)cyclopropane-1-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 308.1±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H8F2O2 |
|---|
| Molecular Weight | 198.166 |
|---|
| Flash Point | 140.1±27.9 °C |
|---|
| Exact Mass | 198.049240 |
|---|
| PSA | 37.30000 |
|---|
| LogP | 1.74 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.556 |
|---|
| InChIKey | CSLVZAGSOJLXCT-NKWVEPMBSA-N |
|---|
| SMILES | O=C(O)C1CC1c1ccc(F)c(F)c1 |
|---|
Safety Information
Synonyms
| trans-2-(3,4-difluorophenyl)cyclopropanecarboxylic acid |
| trans-(1R,2R)-2-(3,4-difluorophenyl)cyclopropanecarboxylic acid |
| (1R,2R)-trans-2-(3,4-difluorophenyl)-1-cyclopropanecarboxylic acid |
| (1R-trans)-2-(3,4-difluorophenyl)-cyclopropanecarboxylic acid |
| Cyclopropanecarboxylic acid, 2-(3,4-difluorophenyl)-, (1R,2R)- |
| (1R,2R)-2-(3,4-Difluorophenyl)cyclopropanecarboxylic acid |
| (1R,2R)-2-(3,4-difluorophenyl)-1-cyclopropanecarboxylic acid |