Introduction:Basic information about CAS 329947-10-6|(5-Chloro-2-methoxyphenyl)-4-pyridinyl-methanone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (5-Chloro-2-methoxyphenyl)-4-pyridinyl-methanone |
|---|
| CAS Number | 329947-10-6 | Molecular Weight | 247.67700 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C13H10ClNO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | (5-chloro-2-methoxyphenyl)-pyridin-4-ylmethanone |
|---|
Chemical & Physical Properties
| Molecular Formula | C13H10ClNO2 |
|---|
| Molecular Weight | 247.67700 |
|---|
| Exact Mass | 247.04000 |
|---|
| PSA | 39.19000 |
|---|
| LogP | 2.97460 |
|---|
| Index of Refraction | 1.583 |
|---|
| InChIKey | ATJHXCIKBZXJGP-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(Cl)cc1C(=O)c1ccncc1 |
|---|