Introduction：Basic information about CAS 10571-59-2|[1-(4-chlorophenyl)-2-methylpropyl] pyridine-3-carboxylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | [1-(4-chlorophenyl)-2-methylpropyl] pyridine-3-carboxylate |
|---|
| CAS Number | 10571-59-2 | Molecular Weight | 289.75700 |
|---|
| Density | 1.188g/cm3 | Boiling Point | 390.1ºC at 760mmHg |
|---|
| Molecular Formula | C16H16ClNO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 189.7ºC |
|---|
Names
| Name | [1-(4-chlorophenyl)-2-methylpropyl] pyridine-3-carboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.188g/cm3 |
|---|
| Boiling Point | 390.1ºC at 760mmHg |
|---|
| Molecular Formula | C16H16ClNO2 |
|---|
| Molecular Weight | 289.75700 |
|---|
| Flash Point | 189.7ºC |
|---|
| Exact Mass | 289.08700 |
|---|
| PSA | 39.19000 |
|---|
| LogP | 4.28910 |
|---|
| Vapour Pressure | 2.72E-06mmHg at 25°C |
|---|
| Index of Refraction | 1.564 |
|---|
| InChIKey | XPPXHQUWVYMTDM-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)C(OC(=O)c1cccnc1)c1ccc(Cl)cc1 |
|---|
Safety Information
Customs
| HS Code | 2933399090 |
|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| Nicoclonatum |
| Nicoclonatum [INN-Latin] |
| Nicoclonato [INN-Spanish] |
| Nicoclonol |
| p-Chlorphenyl-isopropylcarbinol-nicotinat |
| 1-(p-chlorophenyl)-isobutyl nicotinate |
| Nicoclonate |
| 3-pyridinecarboxylic acid 1-(4-chlorophenyl)-2-methylpropyl ester |
| p-Chlorphenyl-isopropylcarbinol-nikotinat |
| Nicoclonato |
