Introduction：Basic information about CAS 2903-48-2|[(2,6-Dimethylphenyl)amino](oxo)acetic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | [(2,6-Dimethylphenyl)amino](oxo)acetic acid |
|---|
| CAS Number | 2903-48-2 | Molecular Weight | 193.199 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C10H11NO3 | Melting Point | 173°C (分解) |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | 2-(2,6-dimethylanilino)-2-oxo-acetic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Melting Point | 173°C (分解) |
|---|
| Molecular Formula | C10H11NO3 |
|---|
| Molecular Weight | 193.199 |
|---|
| Exact Mass | 193.073898 |
|---|
| PSA | 66.40000 |
|---|
| LogP | 1.43 |
|---|
| Index of Refraction | 1.608 |
|---|
| InChIKey | JFTAPSBIODPQJN-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cccc(C)c1NC(=O)C(=O)O |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H302 |
|---|
| Precautionary Statements | P301 + P312 + P330 |
|---|
| Hazard Codes | Xi |
|---|
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| [(2,6-Dimethylphenyl)amino](oxo)acetic acid |
| 2-(2,6-dimethylphenylamino)-2-oxoacetic acid |
| 2,6-Dimethyl-oxanilsaeure [Oxalsaeure-(2,6-anilid)] |
| 2,4,6-Octatriene,2,6-dimethyl-,(E,Z) |
| triene neo-alloocimene |
| InChI=1/C10H16/c1-5-10(4)8-6-7-9(2)3/h5-8H,1-4H3/b8-6+,10-5 |
| N-(2,6-Dimethylphenyl)oxamic Acid |
| (E,Z)-2,6-Dimethylocta-2,4,6-triene |
| Acetic acid, 2-[(2,6-dimethylphenyl)amino]-2-oxo- |
| 2,6-dimethyl-2,trans-4,cis-6-octatriene |
| cis-allocimene |
| trans-allo-ocimene |
| 2,6-dimethyloctatriene-2,trans-4,trans-6 |
| GQVMHMFBVWSSPF-DAIHKBMKSA |
| (4E,6Z)-2,6-Dimethyl-2,4,6-octatriene |
| 4E,6Z-allo-ocimene |
