Introduction:Basic information about CAS 1000341-42-3|Methyl 5-methoxy-7-nitro-1H-indole-2-carboxylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methyl 5-methoxy-7-nitro-1H-indole-2-carboxylate |
|---|
| CAS Number | 1000341-42-3 | Molecular Weight | 250.208 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 467.1±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H10N2O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 236.3±27.3 °C |
|---|
Names
| Name | Methyl 5-methoxy-7-nitro-1H-indole-2-carboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 467.1±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H10N2O5 |
|---|
| Molecular Weight | 250.208 |
|---|
| Flash Point | 236.3±27.3 °C |
|---|
| Exact Mass | 250.058975 |
|---|
| PSA | 97.14000 |
|---|
| LogP | 3.18 |
|---|
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.643 |
|---|
| InChIKey | VEZJPSMVGQWPNA-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1cc2cc(OC)cc([N+](=O)[O-])c2[nH]1 |
|---|
Synonyms
| 5-methoxy-7-methylindoline-2,3-dione |
| 5-methoxy-7-nitro-1H-indole-2-carboxylic acid methyl ester |
| Methyl 5-methoxy-7-nitro-1H-indole-2-carboxylate |
| 7-Methyl-5-methoxy isatin 7-Methyl-5-methoxy indole-2,3-dione |
| 1H-Indole-2-carboxylic acid, 5-methoxy-7-nitro-, methyl ester |
| 5-Methoxy-7-nitro-2-indolecarboxylic acid methyl ester |
| 5-methoxy-7-methyl-isatine |