Introduction：Basic information about CAS 1093-07-8|Fugapavine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Fugapavine |
|---|
| CAS Number | 1093-07-8 | Molecular Weight | 295.33200 |
|---|
| Density | 1.38g/cm3 | Boiling Point | 457.6ºC at 760mmHg |
|---|
| Molecular Formula | C18H17NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 230.5ºC |
|---|
Names
| Name | Mecambrine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.38g/cm3 |
|---|
| Boiling Point | 457.6ºC at 760mmHg |
|---|
| Molecular Formula | C18H17NO3 |
|---|
| Molecular Weight | 295.33200 |
|---|
| Flash Point | 230.5ºC |
|---|
| Exact Mass | 295.12100 |
|---|
| PSA | 38.77000 |
|---|
| LogP | 2.21880 |
|---|
| Vapour Pressure | 1.47E-08mmHg at 25°C |
|---|
| Index of Refraction | 1.689 |
|---|
| InChIKey | NMVDXQMYKKNYFO-ZDUSSCGKSA-N |
|---|
| SMILES | CN1CCc2cc3c(c4c2C1CC41C=CC(=O)C=C1)OCO3 |
|---|
Synonyms
| (-)-Mecambrin |
| Fugapavine |
| (S)-3'-methyl-2'a,3',4',5'-tetrahydro-2'H-spiro[cyclohexa-2,5-diene-1,1'-cyclopenta[ij][1,3]dioxolo[4,5-g]isoquinolin]-4-one |
